C14H24N2O3S — CID 103421004
methyl 3-amino-5-[ethyl(propyl)amino]-4-propan-2-yloxythiophene-2-carboxylate (PubChem CID 103421004) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is methyl 3-amino-5-[ethyl(propyl)amino]-4-propan-2-yloxythiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-[ethyl(propyl)amino]-4-propan-2-yloxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 103421004 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | methyl 3-amino-5-[ethyl(propyl)amino]-4-propan-2-yloxythiophene-2-carboxylate |
| SMILES | CCCN(CC)c1sc(C(=O)OC)c(N)c1OC(C)C |
| InChI | InChI=1S/C14H24N2O3S/c1-6-8-16(7-2)13-11(19-9(3)4)10(15)12(20-13)14(17)18-5/h9H,6-8,15H2,1-5H3 |
| InChIKey | IIFOIOYZSBGEQT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |