C14H21N3O3S — CID 103422466
ethyl 4-amino-5-carbamoyl-2-[cyclopropylmethyl(ethyl)amino]thiophene-3-carboxylate (PubChem CID 103422466) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is ethyl 4-amino-5-carbamoyl-2-[cyclopropylmethyl(ethyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-amino-5-carbamoyl-2-[cyclopropylmethyl(ethyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103422466 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl 4-amino-5-carbamoyl-2-[cyclopropylmethyl(ethyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N(CC)CC2CC2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C14H21N3O3S/c1-3-17(7-8-5-6-8)13-9(14(19)20-4-2)10(15)11(21-13)12(16)18/h8H,3-7,15H2,1-2H3,(H2,16,18) |
| InChIKey | FXOSQZYDMQDFOQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |