C11H15N3O3S — CID 103510123
ethyl 3-amino-4-carbamoyl-5-(prop-2-enylamino)thiophene-2-carboxylate (PubChem CID 103510123) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is ethyl 3-amino-4-carbamoyl-5-(prop-2-enylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-carbamoyl-5-(prop-2-enylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103510123 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | ethyl 3-amino-4-carbamoyl-5-(prop-2-enylamino)thiophene-2-carboxylate |
| SMILES | C=CCNc1sc(C(=O)OCC)c(N)c1C(N)=O |
| InChI | InChI=1S/C11H15N3O3S/c1-3-5-14-10-6(9(13)15)7(12)8(18-10)11(16)17-4-2/h3,14H,1,4-5,12H2,2H3,(H2,13,15) |
| InChIKey | OKTFCDNDUYJTCS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|