C11H16N2O4S2 — CID 103510120
methyl 3-amino-4-ethylsulfonyl-5-(prop-2-enylamino)thiophene-2-carboxylate (PubChem CID 103510120) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-amino-4-ethylsulfonyl-5-(prop-2-enylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-ethylsulfonyl-5-(prop-2-enylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103510120 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 3-amino-4-ethylsulfonyl-5-(prop-2-enylamino)thiophene-2-carboxylate |
| SMILES | C=CCNc1sc(C(=O)OC)c(N)c1S(=O)(=O)CC |
| InChI | InChI=1S/C11H16N2O4S2/c1-4-6-13-10-9(19(15,16)5-2)7(12)8(18-10)11(14)17-3/h4,13H,1,5-6,12H2,2-3H3 |
| InChIKey | VPHPFBGBJPACRM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|