C11H16N2O3S3 — CID 103526630
3-amino-4-ethylsulfonyl-5-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103526630) has the molecular formula C11H16N2O3S3 and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-amino-4-ethylsulfonyl-5-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-ethylsulfonyl-5-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103526630 |
| Molecular Formula | C11H16N2O3S3 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3-amino-4-ethylsulfonyl-5-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(SC)c(S(=O)(=O)CC)c1N |
| InChI | InChI=1S/C11H16N2O3S3/c1-4-6-13-10(14)8-7(12)9(11(17-3)18-8)19(15,16)5-2/h4H,1,5-6,12H2,2-3H3,(H,13,14) |
| InChIKey | DAINZYPKTVVPMC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|