C11H13N3OS2 — CID 103417441
3-amino-4-cyano-5-ethylsulfanyl-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103417441) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-amino-4-cyano-5-ethylsulfanyl-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-ethylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103417441 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-amino-4-cyano-5-ethylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(SCC)c(C#N)c1N |
| InChI | InChI=1S/C11H13N3OS2/c1-3-5-14-10(15)9-8(13)7(6-12)11(17-9)16-4-2/h3H,1,4-5,13H2,2H3,(H,14,15) |
| InChIKey | LTHWZVWVAQQJKV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|