C21H21N5O4S — CID 23997955
3,6-diamino-5-cyano-N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23997955) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23997955 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3,6-diamino-5-cyano-N-prop-2-enyl-4-(3,4,5-trimethoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc2nc(N)c(C#N)c(-c3cc(OC)c(OC)c(OC)c3)c2c1N |
| InChI | InChI=1S/C21H21N5O4S/c1-5-6-25-20(27)18-16(23)15-14(11(9-22)19(24)26-21(15)31-18)10-7-12(28-2)17(30-4)13(8-10)29-3/h5,7-8H,1,6,23H2,2-4H3,(H2,24,26)(H,25,27) |
| InChIKey | BKVNOLQQQDBFFJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|