C23H19N5O3S — CID 23733033
3,6-diamino-5-cyano-N,4-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23733033) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-N,4-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-N,4-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23733033 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3,6-diamino-5-cyano-N,4-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sc3nc(N)c(C#N)c(-c4ccc(OC)cc4)c3c2N)cc1 |
| InChI | InChI=1S/C23H19N5O3S/c1-30-14-7-3-12(4-8-14)17-16(11-24)21(26)28-23-18(17)19(25)20(32-23)22(29)27-13-5-9-15(31-2)10-6-13/h3-10H,25H2,1-2H3,(H2,26,28)(H,27,29) |
| InChIKey | HREWMVFKBPEWCS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |