C13H14N6OS — CID 103434271
3-amino-4-cyano-N-prop-2-enyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carboxamide (PubChem CID 103434271) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-amino-4-cyano-N-prop-2-enyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-N-prop-2-enyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103434271 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-amino-4-cyano-N-prop-2-enyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(NCc2cn[nH]c2)c(C#N)c1N |
| InChI | InChI=1S/C13H14N6OS/c1-2-3-16-12(20)11-10(15)9(4-14)13(21-11)17-5-8-6-18-19-7-8/h2,6-7,17H,1,3,5,15H2,(H,16,20)(H,18,19) |
| InChIKey | RBGFHEXZMDXNTL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|