C13H16N4O3S — CID 103433771
ethyl 5-acetyl-4-amino-2-(1H-pyrazol-4-ylmethylamino)thiophene-3-carboxylate (PubChem CID 103433771) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl 5-acetyl-4-amino-2-(1H-pyrazol-4-ylmethylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-amino-2-(1H-pyrazol-4-ylmethylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103433771 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl 5-acetyl-4-amino-2-(1H-pyrazol-4-ylmethylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NCc2cn[nH]c2)sc(C(C)=O)c1N |
| InChI | InChI=1S/C13H16N4O3S/c1-3-20-13(19)9-10(14)11(7(2)18)21-12(9)15-4-8-5-16-17-6-8/h5-6,15H,3-4,14H2,1-2H3,(H,16,17) |
| InChIKey | IRJGOHOEZQVNIV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |