C12H13N5S — CID 103434310
3-amino-4-cyclopropyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carbonitrile (PubChem CID 103434310) has the molecular formula C12H13N5S and a molecular weight of 259.34 g/mol. Its IUPAC name is 3-amino-4-cyclopropyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-cyclopropyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103434310 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-amino-4-cyclopropyl-5-(1H-pyrazol-4-ylmethylamino)thiophene-2-carbonitrile |
| SMILES | N#Cc1sc(NCc2cn[nH]c2)c(C2CC2)c1N |
| InChI | InChI=1S/C12H13N5S/c13-3-9-11(14)10(8-1-2-8)12(18-9)15-4-7-5-16-17-6-7/h5-6,8,15H,1-2,4,14H2,(H,16,17) |
| InChIKey | KBSNXVKAKDKJKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |