C14H19N3S — CID 103423008
3-amino-5-(cyclohexylamino)-4-cyclopropylthiophene-2-carbonitrile (PubChem CID 103423008) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-amino-5-(cyclohexylamino)-4-cyclopropylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(cyclohexylamino)-4-cyclopropylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103423008 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-amino-5-(cyclohexylamino)-4-cyclopropylthiophene-2-carbonitrile |
| SMILES | N#Cc1sc(NC2CCCCC2)c(C2CC2)c1N |
| InChI | InChI=1S/C14H19N3S/c15-8-11-13(16)12(9-6-7-9)14(18-11)17-10-4-2-1-3-5-10/h9-10,17H,1-7,16H2 |
| InChIKey | BJZSVWLBRPJMQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |