C13H17N3S — CID 103427607
3-amino-4-cyclopropyl-5-(1-cyclopropylethylamino)thiophene-2-carbonitrile (PubChem CID 103427607) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 3-amino-4-cyclopropyl-5-(1-cyclopropylethylamino)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-cyclopropyl-5-(1-cyclopropylethylamino)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103427607 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-amino-4-cyclopropyl-5-(1-cyclopropylethylamino)thiophene-2-carbonitrile |
| SMILES | CC(Nc1sc(C#N)c(N)c1C1CC1)C1CC1 |
| InChI | InChI=1S/C13H17N3S/c1-7(8-2-3-8)16-13-11(9-4-5-9)12(15)10(6-14)17-13/h7-9,16H,2-5,15H2,1H3 |
| InChIKey | LIKVLPOPTNKXSP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |