C10H9N5 — CID 115490190
5-(1H-pyrazol-4-ylmethylamino)pyridine-2-carbonitrile (PubChem CID 115490190) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 5-(1H-pyrazol-4-ylmethylamino)pyridine-2-carbonitrile.
| Compound Name | 5-(1H-pyrazol-4-ylmethylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115490190 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5-(1H-pyrazol-4-ylmethylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCc2cn[nH]c2)cn1 |
| InChI | InChI=1S/C10H9N5/c11-3-9-1-2-10(7-13-9)12-4-8-5-14-15-6-8/h1-2,5-7,12H,4H2,(H,14,15) |
| InChIKey | LJYJZVMFGIONJF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |