C17H15N5 — CID 122142016
5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridine-2-carbonitrile (PubChem CID 122142016) has the molecular formula C17H15N5 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridine-2-carbonitrile.
| Compound Name | 5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 122142016 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCc2cccc(Cn3cccn3)c2)cn1 |
| InChI | InChI=1S/C17H15N5/c18-10-16-5-6-17(12-20-16)19-11-14-3-1-4-15(9-14)13-22-8-2-7-21-22/h1-9,12,19H,11,13H2 |
| InChIKey | PKQDHBUSCKDWEA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |