C16H16BrN5O — CID 133303721
4-bromo-2-methyl-5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridazin-3-one (PubChem CID 133303721) has the molecular formula C16H16BrN5O and a molecular weight of 374.24 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 133303721 |
| Molecular Formula | C16H16BrN5O |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 4-bromo-2-methyl-5-[[3-(pyrazol-1-ylmethyl)phenyl]methylamino]pyridazin-3-one |
| SMILES | Cn1ncc(NCc2cccc(Cn3cccn3)c2)c(Br)c1=O |
| InChI | InChI=1S/C16H16BrN5O/c1-21-16(23)15(17)14(10-20-21)18-9-12-4-2-5-13(8-12)11-22-7-3-6-19-22/h2-8,10,18H,9,11H2,1H3 |
| InChIKey | NSNQTCFWNJQVJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |