C13H15BrN4O3S — CID 133303380
3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]-N-methylbenzenesulfonamide (PubChem CID 133303380) has the molecular formula C13H15BrN4O3S and a molecular weight of 387.26 g/mol. Its IUPAC name is 3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 133303380 |
| Molecular Formula | C13H15BrN4O3S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(CNc2cnn(C)c(=O)c2Br)c1 |
| InChI | InChI=1S/C13H15BrN4O3S/c1-15-22(20,21)10-5-3-4-9(6-10)7-16-11-8-17-18(2)13(19)12(11)14/h3-6,8,15-16H,7H2,1-2H3 |
| InChIKey | UNBYWJZYIUAHTC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |