C14H16BrN3O2S — CID 133373833
3-[[(5-bromo-3-methyl-2-pyridinyl)amino]methyl]-N-methylbenzenesulfonamide (PubChem CID 133373833) has the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-[[(5-bromo-3-methyl-2-pyridinyl)amino]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-[[(5-bromo-3-methyl-2-pyridinyl)amino]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 133373833 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 3-[[(5-bromo-3-methyl-2-pyridinyl)amino]methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(CNc2ncc(Br)cc2C)c1 |
| InChI | InChI=1S/C14H16BrN3O2S/c1-10-6-12(15)9-18-14(10)17-8-11-4-3-5-13(7-11)21(19,20)16-2/h3-7,9,16H,8H2,1-2H3,(H,17,18) |
| InChIKey | IVKMBCUSUGGHLN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |