C17H15BrClN3O2S — CID 133436656
3-[[(6-bromo-8-chloroquinolin-2-yl)amino]methyl]-N-methylbenzenesulfonamide (PubChem CID 133436656) has the molecular formula C17H15BrClN3O2S and a molecular weight of 440.75 g/mol. Its IUPAC name is 3-[[(6-bromo-8-chloroquinolin-2-yl)amino]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 3-[[(6-bromo-8-chloroquinolin-2-yl)amino]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 133436656 |
| Molecular Formula | C17H15BrClN3O2S |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 3-[[(6-bromo-8-chloroquinolin-2-yl)amino]methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(CNc2ccc3cc(Br)cc(Cl)c3n2)c1 |
| InChI | InChI=1S/C17H15BrClN3O2S/c1-20-25(23,24)14-4-2-3-11(7-14)10-21-16-6-5-12-8-13(18)9-15(19)17(12)22-16/h2-9,20H,10H2,1H3,(H,21,22) |
| InChIKey | VUYLLSZAZPSHRV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |