C12H13ClN2O4S3 — CID 154848358
4-chloro-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-3-sulfonamide (PubChem CID 154848358) has the molecular formula C12H13ClN2O4S3 and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-chloro-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-3-sulfonamide.
| Compound Name | 4-chloro-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 154848358 |
| Molecular Formula | C12H13ClN2O4S3 |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 4-chloro-N-[[3-(methylsulfamoyl)phenyl]methyl]thiophene-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(CNS(=O)(=O)c2cscc2Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O4S3/c1-14-21(16,17)10-4-2-3-9(5-10)6-15-22(18,19)12-8-20-7-11(12)13/h2-5,7-8,14-15H,6H2,1H3 |
| InChIKey | ZWBGRVJXYZBXTA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |