C18H21BrN4O2 — CID 133303678
N-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 133303678) has the molecular formula C18H21BrN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is N-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 133303678 |
| Molecular Formula | C18H21BrN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | Cn1ncc(NCc2cccc(NC(=O)C3CCCC3)c2)c(Br)c1=O |
| InChI | InChI=1S/C18H21BrN4O2/c1-23-18(25)16(19)15(11-21-23)20-10-12-5-4-8-14(9-12)22-17(24)13-6-2-3-7-13/h4-5,8-9,11,13,20H,2-3,6-7,10H2,1H3,(H,22,24) |
| InChIKey | KYIQHOKJQMQBRE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |