C20H20BrN5O2 — CID 133303650
1-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]-3-(3-methylphenyl)urea (PubChem CID 133303650) has the molecular formula C20H20BrN5O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is 1-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 133303650 |
| Molecular Formula | C20H20BrN5O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 1-[3-[[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]methyl]phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNc3cnn(C)c(=O)c3Br)c2)c1 |
| InChI | InChI=1S/C20H20BrN5O2/c1-13-5-3-7-15(9-13)24-20(28)25-16-8-4-6-14(10-16)11-22-17-12-23-26(2)19(27)18(17)21/h3-10,12,22H,11H2,1-2H3,(H2,24,25,28) |
| InChIKey | SVJPHGBMURPGHS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |