C13H13BrFN3O2 — CID 114432816
4-bromo-5-[(3-fluorophenyl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114432816) has the molecular formula C13H13BrFN3O2 and a molecular weight of 342.17 g/mol. Its IUPAC name is 4-bromo-5-[(3-fluorophenyl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-[(3-fluorophenyl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114432816 |
| Molecular Formula | C13H13BrFN3O2 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-bromo-5-[(3-fluorophenyl)methylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCc2cccc(F)c2)cnn1CCO |
| InChI | InChI=1S/C13H13BrFN3O2/c14-12-11(8-17-18(4-5-19)13(12)20)16-7-9-2-1-3-10(15)6-9/h1-3,6,8,16,19H,4-5,7H2 |
| InChIKey | WPIDIFJJSIBZCK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |