C13H11BrF3N3O — CID 114432047
5-(benzylamino)-4-bromo-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114432047) has the molecular formula C13H11BrF3N3O and a molecular weight of 362.15 g/mol. Its IUPAC name is 5-(benzylamino)-4-bromo-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 5-(benzylamino)-4-bromo-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114432047 |
| Molecular Formula | C13H11BrF3N3O |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 5-(benzylamino)-4-bromo-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCc2ccccc2)cnn1CC(F)(F)F |
| InChI | InChI=1S/C13H11BrF3N3O/c14-11-10(18-6-9-4-2-1-3-5-9)7-19-20(12(11)21)8-13(15,16)17/h1-5,7,18H,6,8H2 |
| InChIKey | CPKBWUWFZQKGTR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |