C9H12BrF3N4O3S — CID 114433499
N-[2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 114433499) has the molecular formula C9H12BrF3N4O3S and a molecular weight of 393.19 g/mol. Its IUPAC name is N-[2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 114433499 |
| Molecular Formula | C9H12BrF3N4O3S |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-[2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1cnn(CC(F)(F)F)c(=O)c1Br |
| InChI | InChI=1S/C9H12BrF3N4O3S/c1-21(19,20)16-3-2-14-6-4-15-17(5-9(11,12)13)8(18)7(6)10/h4,14,16H,2-3,5H2,1H3 |
| InChIKey | BSOQFWKLDUQSRQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|