C11H11BrF3N3O — CID 106222606
4-bromo-5-(pent-4-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 106222606) has the molecular formula C11H11BrF3N3O and a molecular weight of 338.13 g/mol. Its IUPAC name is 4-bromo-5-(pent-4-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-(pent-4-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 106222606 |
| Molecular Formula | C11H11BrF3N3O |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 4-bromo-5-(pent-4-ynylamino)-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | C#CCCCNc1cnn(CC(F)(F)F)c(=O)c1Br |
| InChI | InChI=1S/C11H11BrF3N3O/c1-2-3-4-5-16-8-6-17-18(7-11(13,14)15)10(19)9(8)12/h1,6,16H,3-5,7H2 |
| InChIKey | RHFSKPBXTBOJET-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|