C10H9ClF3N3O — CID 114438427
5-(but-3-ynylamino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114438427) has the molecular formula C10H9ClF3N3O and a molecular weight of 279.65 g/mol. Its IUPAC name is 5-(but-3-ynylamino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 5-(but-3-ynylamino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114438427 |
| Molecular Formula | C10H9ClF3N3O |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-(but-3-ynylamino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | C#CCCNc1cnn(CC(F)(F)F)c(=O)c1Cl |
| InChI | InChI=1S/C10H9ClF3N3O/c1-2-3-4-15-7-5-16-17(6-10(12,13)14)9(18)8(7)11/h1,5,15H,3-4,6H2 |
| InChIKey | OOCQWDNYTGVONO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|