C9H10ClF3N4O3 — CID 114441267
2-[[5-chloro-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl carbamate (PubChem CID 114441267) has the molecular formula C9H10ClF3N4O3 and a molecular weight of 314.65 g/mol. Its IUPAC name is 2-[[5-chloro-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-chloro-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 114441267 |
| Molecular Formula | C9H10ClF3N4O3 |
| Molecular Weight | 314.65 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-[[5-chloro-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cnn(CC(F)(F)F)c(=O)c1Cl |
| InChI | InChI=1S/C9H10ClF3N4O3/c10-6-5(15-1-2-20-8(14)19)3-16-17(7(6)18)4-9(11,12)13/h3,15H,1-2,4H2,(H2,14,19) |
| InChIKey | GFGRJNUTMVZCFU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.65 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|