C9H13ClN4O4 — CID 114441285
2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl carbamate (PubChem CID 114441285) has the molecular formula C9H13ClN4O4 and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 114441285 |
| Molecular Formula | C9H13ClN4O4 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C9H13ClN4O4/c10-7-6(12-1-4-18-9(11)17)5-13-14(2-3-15)8(7)16/h5,12,15H,1-4H2,(H2,11,17) |
| InChIKey | FKJPPGOXNCBNKW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|