C8H11ClN4O3 — CID 114431801
2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]acetamide (PubChem CID 114431801) has the molecular formula C8H11ClN4O3 and a molecular weight of 246.65 g/mol. Its IUPAC name is 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]acetamide.
| Compound Name | 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 114431801 |
| Molecular Formula | C8H11ClN4O3 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-[[5-chloro-1-(2-hydroxyethyl)-6-oxopyridazin-4-yl]amino]acetamide |
| SMILES | NC(=O)CNc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C8H11ClN4O3/c9-7-5(11-4-6(10)15)3-12-13(1-2-14)8(7)16/h3,11,14H,1-2,4H2,(H2,10,15) |
| InChIKey | QFXWEDZPAWMXHP-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |