C14H15Cl2N3O2 — CID 114435208
4-chloro-5-[2-(4-chlorophenyl)ethylamino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114435208) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 4-chloro-5-[2-(4-chlorophenyl)ethylamino]-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(4-chlorophenyl)ethylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114435208 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-chloro-5-[2-(4-chlorophenyl)ethylamino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCc2ccc(Cl)cc2)cnn1CCO |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-11-3-1-10(2-4-11)5-6-17-12-9-18-19(7-8-20)14(21)13(12)16/h1-4,9,17,20H,5-8H2 |
| InChIKey | NFVJFTLHVQWMHY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |