C10H17ClN4O2 — CID 114444841
5-(3-aminobutylamino)-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114444841) has the molecular formula C10H17ClN4O2 and a molecular weight of 260.73 g/mol. Its IUPAC name is 5-(3-aminobutylamino)-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-(3-aminobutylamino)-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114444841 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-(3-aminobutylamino)-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | CC(N)CCNc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C10H17ClN4O2/c1-7(12)2-3-13-8-6-14-15(4-5-16)10(17)9(8)11/h6-7,13,16H,2-5,12H2,1H3 |
| InChIKey | AIFHDBWMGQAGGH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |