C13H15ClN4O2 — CID 114433930
4-chloro-2-(2-hydroxyethyl)-5-(2-pyridin-3-ylethylamino)pyridazin-3-one (PubChem CID 114433930) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-(2-pyridin-3-ylethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-(2-pyridin-3-ylethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114433930 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-(2-pyridin-3-ylethylamino)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NCCc2cccnc2)cnn1CCO |
| InChI | InChI=1S/C13H15ClN4O2/c14-12-11(9-17-18(6-7-19)13(12)20)16-5-3-10-2-1-4-15-8-10/h1-2,4,8-9,16,19H,3,5-7H2 |
| InChIKey | AKGOUDRMZLEBNA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |