C11H15ClN6O2 — CID 114446277
5-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114446277) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 5-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 5-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114446277 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[(5-amino-1-methylpyrazol-4-yl)methylamino]-4-chloro-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | Cn1ncc(CNc2cnn(CCO)c(=O)c2Cl)c1N |
| InChI | InChI=1S/C11H15ClN6O2/c1-17-10(13)7(5-15-17)4-14-8-6-16-18(2-3-19)11(20)9(8)12/h5-6,14,19H,2-4,13H2,1H3 |
| InChIKey | MDVQCLPVYPXKGS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |