C12H20ClN3O3 — CID 114437198
4-chloro-2-(2-hydroxyethyl)-5-[3-(hydroxymethyl)pentan-3-ylamino]pyridazin-3-one (PubChem CID 114437198) has the molecular formula C12H20ClN3O3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-[3-(hydroxymethyl)pentan-3-ylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-[3-(hydroxymethyl)pentan-3-ylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114437198 |
| Molecular Formula | C12H20ClN3O3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-[3-(hydroxymethyl)pentan-3-ylamino]pyridazin-3-one |
| SMILES | CCC(CC)(CO)Nc1cnn(CCO)c(=O)c1Cl |
| InChI | InChI=1S/C12H20ClN3O3/c1-3-12(4-2,8-18)15-9-7-14-16(5-6-17)11(19)10(9)13/h7,15,17-18H,3-6,8H2,1-2H3 |
| InChIKey | CLAVYSWRSPPGFH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |