C14H24ClN3O3 — CID 103844418
4-chloro-5-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 103844418) has the molecular formula C14H24ClN3O3 and a molecular weight of 317.82 g/mol. Its IUPAC name is 4-chloro-5-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103844418 |
| Molecular Formula | C14H24ClN3O3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-chloro-5-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | CCC(CC)(CO)CNc1cnn(CCOC)c(=O)c1Cl |
| InChI | InChI=1S/C14H24ClN3O3/c1-4-14(5-2,10-19)9-16-11-8-17-18(6-7-21-3)13(20)12(11)15/h8,16,19H,4-7,9-10H2,1-3H3 |
| InChIKey | MWVKTSOIHUMGAE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |