C11H18ClN3O3 — CID 113234186
4-chloro-5-[(2-hydroxy-2-methylpropyl)amino]-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 113234186) has the molecular formula C11H18ClN3O3 and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-5-[(2-hydroxy-2-methylpropyl)amino]-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(2-hydroxy-2-methylpropyl)amino]-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 113234186 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-chloro-5-[(2-hydroxy-2-methylpropyl)amino]-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(NCC(C)(C)O)c(Cl)c1=O |
| InChI | InChI=1S/C11H18ClN3O3/c1-11(2,17)7-13-8-6-14-15(4-5-18-3)10(16)9(8)12/h6,13,17H,4-5,7H2,1-3H3 |
| InChIKey | CJZYCOKBNQRXRP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |