C12H21ClN4O2 — CID 115898938
4-chloro-5-[2-[ethyl(methyl)amino]ethylamino]-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 115898938) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-chloro-5-[2-[ethyl(methyl)amino]ethylamino]-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-[ethyl(methyl)amino]ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 115898938 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-chloro-5-[2-[ethyl(methyl)amino]ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | CCN(C)CCNc1cnn(CCOC)c(=O)c1Cl |
| InChI | InChI=1S/C12H21ClN4O2/c1-4-16(2)6-5-14-10-9-15-17(7-8-19-3)12(18)11(10)13/h9,14H,4-8H2,1-3H3 |
| InChIKey | KJYTUSCMJWUWKG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |