C10H17ClN4O4S — CID 114436529
3-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]propane-1-sulfonamide (PubChem CID 114436529) has the molecular formula C10H17ClN4O4S and a molecular weight of 324.79 g/mol. Its IUPAC name is 3-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 114436529 |
| Molecular Formula | C10H17ClN4O4S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-[[5-chloro-1-(2-methoxyethyl)-6-oxopyridazin-4-yl]amino]propane-1-sulfonamide |
| SMILES | COCCn1ncc(NCCCS(N)(=O)=O)c(Cl)c1=O |
| InChI | InChI=1S/C10H17ClN4O4S/c1-19-5-4-15-10(16)9(11)8(7-14-15)13-3-2-6-20(12,17)18/h7,13H,2-6H2,1H3,(H2,12,17,18) |
| InChIKey | GHMKEJJJOMUHFD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|