C11H16ClF2N3O3 — CID 103081526
4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 103081526) has the molecular formula C11H16ClF2N3O3 and a molecular weight of 311.72 g/mol. Its IUPAC name is 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 103081526 |
| Molecular Formula | C11H16ClF2N3O3 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(NCCOCC(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C11H16ClF2N3O3/c1-19-5-3-17-11(18)10(12)8(6-16-17)15-2-4-20-7-9(13)14/h6,9,15H,2-5,7H2,1H3 |
| InChIKey | IGVIIADTSPNDQO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|