C13H22ClN3O3 — CID 114436398
4-chloro-5-[2-(2-methoxyethoxy)ethylamino]-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114436398) has the molecular formula C13H22ClN3O3 and a molecular weight of 303.79 g/mol. Its IUPAC name is 4-chloro-5-[2-(2-methoxyethoxy)ethylamino]-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2-methoxyethoxy)ethylamino]-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114436398 |
| Molecular Formula | C13H22ClN3O3 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-chloro-5-[2-(2-methoxyethoxy)ethylamino]-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | COCCOCCNc1cnn(CC(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C13H22ClN3O3/c1-10(2)9-17-13(18)12(14)11(8-16-17)15-4-5-20-7-6-19-3/h8,10,15H,4-7,9H2,1-3H3 |
| InChIKey | JJRYQUFPDADRCJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|