C11H19ClN4O2 — CID 115573762
4-chloro-5-[2-(dimethylamino)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 115573762) has the molecular formula C11H19ClN4O2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 4-chloro-5-[2-(dimethylamino)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(dimethylamino)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 115573762 |
| Molecular Formula | C11H19ClN4O2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-chloro-5-[2-(dimethylamino)ethylamino]-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(NCCN(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C11H19ClN4O2/c1-15(2)5-4-13-9-8-14-16(6-7-18-3)11(17)10(9)12/h8,13H,4-7H2,1-3H3 |
| InChIKey | GXTYXYMLUVPBLA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |