C11H18ClN5O3 — CID 114441286
2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl carbamate (PubChem CID 114441286) has the molecular formula C11H18ClN5O3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl carbamate.
| Compound Name | 2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 114441286 |
| Molecular Formula | C11H18ClN5O3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl carbamate |
| SMILES | CN(C)CCn1ncc(NCCOC(N)=O)c(Cl)c1=O |
| InChI | InChI=1S/C11H18ClN5O3/c1-16(2)4-5-17-10(18)9(12)8(7-15-17)14-3-6-20-11(13)19/h7,14H,3-6H2,1-2H3,(H2,13,19) |
| InChIKey | LOGWHKLKOVXXRV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|