C12H20ClN5O2 — CID 114433901
4-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]butanamide (PubChem CID 114433901) has the molecular formula C12H20ClN5O2 and a molecular weight of 301.78 g/mol. Its IUPAC name is 4-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]butanamide.
| Compound Name | 4-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]butanamide |
|---|---|
| PubChem CID | 114433901 |
| Molecular Formula | C12H20ClN5O2 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]butanamide |
| SMILES | CN(C)CCn1ncc(NCCCC(N)=O)c(Cl)c1=O |
| InChI | InChI=1S/C12H20ClN5O2/c1-17(2)6-7-18-12(20)11(13)9(8-16-18)15-5-3-4-10(14)19/h8,15H,3-7H2,1-2H3,(H2,14,19) |
| InChIKey | LHOQLPJVIZFHFK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|