C12H17ClN4O — CID 114438445
5-(but-3-ynylamino)-4-chloro-2-[2-(dimethylamino)ethyl]pyridazin-3-one (PubChem CID 114438445) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-(but-3-ynylamino)-4-chloro-2-[2-(dimethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-(but-3-ynylamino)-4-chloro-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114438445 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-(but-3-ynylamino)-4-chloro-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
| SMILES | C#CCCNc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C12H17ClN4O/c1-4-5-6-14-10-9-15-17(8-7-16(2)3)12(18)11(10)13/h1,9,14H,5-8H2,2-3H3 |
| InChIKey | UVPWZBSGQBDEOC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|