C12H20ClN5O2 — CID 114436512
3-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]-N-methylpropanamide (PubChem CID 114436512) has the molecular formula C12H20ClN5O2 and a molecular weight of 301.78 g/mol. Its IUPAC name is 3-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]-N-methylpropanamide.
| Compound Name | 3-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 114436512 |
| Molecular Formula | C12H20ClN5O2 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C12H20ClN5O2/c1-14-10(19)4-5-15-9-8-16-18(7-6-17(2)3)12(20)11(9)13/h8,15H,4-7H2,1-3H3,(H,14,19) |
| InChIKey | MGQLXPYGFXAEMJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |