C13H24ClN5O — CID 114444114
4-chloro-2-[2-(dimethylamino)ethyl]-5-[3-(ethylamino)propylamino]pyridazin-3-one (PubChem CID 114444114) has the molecular formula C13H24ClN5O and a molecular weight of 301.82 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-[3-(ethylamino)propylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-[3-(ethylamino)propylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114444114 |
| Molecular Formula | C13H24ClN5O |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-[3-(ethylamino)propylamino]pyridazin-3-one |
| SMILES | CCNCCCNc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C13H24ClN5O/c1-4-15-6-5-7-16-11-10-17-19(9-8-18(2)3)13(20)12(11)14/h10,15-16H,4-9H2,1-3H3 |
| InChIKey | XIAHTDXPRCDTSE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|