C11H20ClN5O3S — CID 114433518
N-[2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 114433518) has the molecular formula C11H20ClN5O3S and a molecular weight of 337.83 g/mol. Its IUPAC name is N-[2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 114433518 |
| Molecular Formula | C11H20ClN5O3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[2-[[5-chloro-1-[2-(dimethylamino)ethyl]-6-oxopyridazin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CN(C)CCn1ncc(NCCNS(C)(=O)=O)c(Cl)c1=O |
| InChI | InChI=1S/C11H20ClN5O3S/c1-16(2)6-7-17-11(18)10(12)9(8-14-17)13-4-5-15-21(3,19)20/h8,13,15H,4-7H2,1-3H3 |
| InChIKey | XXLKALMFTMCGAZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|