C12H21ClN4O3S — CID 114438987
4-chloro-2-[2-(dimethylamino)ethyl]-5-(1-methylsulfonylpropan-2-ylamino)pyridazin-3-one (PubChem CID 114438987) has the molecular formula C12H21ClN4O3S and a molecular weight of 336.85 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-(1-methylsulfonylpropan-2-ylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(1-methylsulfonylpropan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114438987 |
| Molecular Formula | C12H21ClN4O3S |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(1-methylsulfonylpropan-2-ylamino)pyridazin-3-one |
| SMILES | CC(CS(C)(=O)=O)Nc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C12H21ClN4O3S/c1-9(8-21(4,19)20)15-10-7-14-17(6-5-16(2)3)12(18)11(10)13/h7,9,15H,5-6,8H2,1-4H3 |
| InChIKey | SGSLXMPTAPLVIP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |