C14H25ClN4OS — CID 114443381
4-chloro-2-[2-(dimethylamino)ethyl]-5-(4-ethylsulfanylbutan-2-ylamino)pyridazin-3-one (PubChem CID 114443381) has the molecular formula C14H25ClN4OS and a molecular weight of 332.90 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-(4-ethylsulfanylbutan-2-ylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(4-ethylsulfanylbutan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114443381 |
| Molecular Formula | C14H25ClN4OS |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(4-ethylsulfanylbutan-2-ylamino)pyridazin-3-one |
| SMILES | CCSCCC(C)Nc1cnn(CCN(C)C)c(=O)c1Cl |
| InChI | InChI=1S/C14H25ClN4OS/c1-5-21-9-6-11(2)17-12-10-16-19(8-7-18(3)4)14(20)13(12)15/h10-11,17H,5-9H2,1-4H3 |
| InChIKey | SQOCWGZGXFVXLQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|